C22H24N4O4 — CID 135977022
1-N,4-N-bis[(Z)-(2-hydroxyphenyl)methylideneamino]cyclohexane-1,4-dicarboxamide (PubChem CID 135977022) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is 1-N,4-N-bis[(Z)-(2-hydroxyphenyl)methylideneamino]cyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[(Z)-(2-hydroxyphenyl)methylideneamino]cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 135977022 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 1-N,4-N-bis[(Z)-(2-hydroxyphenyl)methylideneamino]cyclohexane-1,4-dicarboxamide |
| SMILES | O=C(N/N=C\c1ccccc1O)C1CCC(C(=O)N/N=C\c2ccccc2O)CC1 |
| InChI | InChI=1S/C22H24N4O4/c27-19-7-3-1-5-17(19)13-23-25-21(29)15-9-11-16(12-10-15)22(30)26-24-14-18-6-2-4-8-20(18)28/h1-8,13-16,27-28H,9-12H2,(H,25,29)(H,26,30)/b23-13-,24-14- |
| InChIKey | DLRLQYGRNOHATF-GACBQCINSA-N |
| XLogP | 2.50 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|