C15H14N2O — CID 5420009
N-[(Z)-naphthalen-1-ylmethylideneamino]cyclopropanecarboxamide (PubChem CID 5420009) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is N-[(Z)-naphthalen-1-ylmethylideneamino]cyclopropanecarboxamide.
| Compound Name | N-[(Z)-naphthalen-1-ylmethylideneamino]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 5420009 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | N-[(Z)-naphthalen-1-ylmethylideneamino]cyclopropanecarboxamide |
| SMILES | O=C(N/N=C\c1cccc2ccccc12)C1CC1 |
| InChI | InChI=1S/C15H14N2O/c18-15(12-8-9-12)17-16-10-13-6-3-5-11-4-1-2-7-14(11)13/h1-7,10,12H,8-9H2,(H,17,18)/b16-10- |
| InChIKey | WBCUJOYFTSTHAO-YBEGLDIGSA-N |
| XLogP | 2.70 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|