C19H16N2O — CID 5407611
N-[(Z)-naphthalen-1-ylmethylideneamino]-2-phenylacetamide (PubChem CID 5407611) has the molecular formula C19H16N2O and a molecular weight of 288.35 g/mol. Its IUPAC name is N-[(Z)-naphthalen-1-ylmethylideneamino]-2-phenylacetamide.
| Compound Name | N-[(Z)-naphthalen-1-ylmethylideneamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 5407611 |
| Molecular Formula | C19H16N2O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | N-[(Z)-naphthalen-1-ylmethylideneamino]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)N/N=C\c1cccc2ccccc12 |
| InChI | InChI=1S/C19H16N2O/c22-19(13-15-7-2-1-3-8-15)21-20-14-17-11-6-10-16-9-4-5-12-18(16)17/h1-12,14H,13H2,(H,21,22)/b20-14- |
| InChIKey | YVVZBOVYCGFUMB-ZHZULCJRSA-N |
| XLogP | 3.53 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|