C25H20N2O4S — CID 87904866
1-[2-[(E)-[(2-phenylacetyl)hydrazinylidene]methyl]phenyl]naphthalene-2-sulfonic acid (PubChem CID 87904866) has the molecular formula C25H20N2O4S and a molecular weight of 444.51 g/mol. Its IUPAC name is 1-[2-[(E)-[(2-phenylacetyl)hydrazinylidene]methyl]phenyl]naphthalene-2-sulfonic acid.
| Compound Name | 1-[2-[(E)-[(2-phenylacetyl)hydrazinylidene]methyl]phenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 87904866 |
| Molecular Formula | C25H20N2O4S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 1-[2-[(E)-[(2-phenylacetyl)hydrazinylidene]methyl]phenyl]naphthalene-2-sulfonic acid |
| SMILES | O=C(Cc1ccccc1)N/N=C/c1ccccc1-c1c(S(=O)(=O)O)ccc2ccccc12 |
| InChI | InChI=1S/C25H20N2O4S/c28-24(16-18-8-2-1-3-9-18)27-26-17-20-11-5-7-13-22(20)25-21-12-6-4-10-19(21)14-15-23(25)32(29,30)31/h1-15,17H,16H2,(H,27,28)(H,29,30,31)/b26-17+ |
| InChIKey | QQWLLISYUWIBGJ-YZSQISJMSA-N |
| XLogP | 4.45 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|