C27H22N2O4S — CID 87904857
4-phenyl-3-[2-[(E)-[(2-phenylacetyl)hydrazinylidene]methyl]phenyl]benzenesulfonic acid (PubChem CID 87904857) has the molecular formula C27H22N2O4S and a molecular weight of 470.55 g/mol. Its IUPAC name is 4-phenyl-3-[2-[(E)-[(2-phenylacetyl)hydrazinylidene]methyl]phenyl]benzenesulfonic acid.
| Compound Name | 4-phenyl-3-[2-[(E)-[(2-phenylacetyl)hydrazinylidene]methyl]phenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 87904857 |
| Molecular Formula | C27H22N2O4S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 4-phenyl-3-[2-[(E)-[(2-phenylacetyl)hydrazinylidene]methyl]phenyl]benzenesulfonic acid |
| SMILES | O=C(Cc1ccccc1)N/N=C/c1ccccc1-c1cc(S(=O)(=O)O)ccc1-c1ccccc1 |
| InChI | InChI=1S/C27H22N2O4S/c30-27(17-20-9-3-1-4-10-20)29-28-19-22-13-7-8-14-24(22)26-18-23(34(31,32)33)15-16-25(26)21-11-5-2-6-12-21/h1-16,18-19H,17H2,(H,29,30)(H,31,32,33)/b28-19+ |
| InChIKey | MDCJMEPHGNIJIK-TURZUDJPSA-N |
| XLogP | 4.96 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|