C19H16N2O4S2 — CID 87904856
3-[2-[(E)-[(2-phenylacetyl)hydrazinylidene]methyl]phenyl]thiophene-2-sulfonic acid (PubChem CID 87904856) has the molecular formula C19H16N2O4S2 and a molecular weight of 400.48 g/mol. Its IUPAC name is 3-[2-[(E)-[(2-phenylacetyl)hydrazinylidene]methyl]phenyl]thiophene-2-sulfonic acid.
| Compound Name | 3-[2-[(E)-[(2-phenylacetyl)hydrazinylidene]methyl]phenyl]thiophene-2-sulfonic acid |
|---|---|
| PubChem CID | 87904856 |
| Molecular Formula | C19H16N2O4S2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 3-[2-[(E)-[(2-phenylacetyl)hydrazinylidene]methyl]phenyl]thiophene-2-sulfonic acid |
| SMILES | O=C(Cc1ccccc1)N/N=C/c1ccccc1-c1ccsc1S(=O)(=O)O |
| InChI | InChI=1S/C19H16N2O4S2/c22-18(12-14-6-2-1-3-7-14)21-20-13-15-8-4-5-9-16(15)17-10-11-26-19(17)27(23,24)25/h1-11,13H,12H2,(H,21,22)(H,23,24,25)/b20-13+ |
| InChIKey | YLOLNIGDUHKFDC-DEDYPNTBSA-N |
| XLogP | 3.35 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|