C24H24N2O6S — CID 87989794
2-methoxy-6-[2-[(E)-[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]phenyl]-4-methylbenzenesulfonic acid (PubChem CID 87989794) has the molecular formula C24H24N2O6S and a molecular weight of 468.53 g/mol. Its IUPAC name is 2-methoxy-6-[2-[(E)-[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]phenyl]-4-methylbenzenesulfonic acid.
| Compound Name | 2-methoxy-6-[2-[(E)-[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]phenyl]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87989794 |
| Molecular Formula | C24H24N2O6S |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 2-methoxy-6-[2-[(E)-[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]phenyl]-4-methylbenzenesulfonic acid |
| SMILES | COc1cccc(CC(=O)N/N=C/c2ccccc2-c2cc(C)cc(OC)c2S(=O)(=O)O)c1 |
| InChI | InChI=1S/C24H24N2O6S/c1-16-11-21(24(33(28,29)30)22(12-16)32-3)20-10-5-4-8-18(20)15-25-26-23(27)14-17-7-6-9-19(13-17)31-2/h4-13,15H,14H2,1-3H3,(H,26,27)(H,28,29,30)/b25-15+ |
| InChIKey | UFCLOVPVOKSCRD-MFKUBSTISA-N |
| XLogP | 3.62 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|