C25H26N2O6S — CID 22185677
phenyl 2-ethoxy-6-[(E)-[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]-4-methylbenzenesulfonate (PubChem CID 22185677) has the molecular formula C25H26N2O6S and a molecular weight of 482.56 g/mol. Its IUPAC name is phenyl 2-ethoxy-6-[(E)-[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]-4-methylbenzenesulfonate.
| Compound Name | phenyl 2-ethoxy-6-[(E)-[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]-4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 22185677 |
| Molecular Formula | C25H26N2O6S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | phenyl 2-ethoxy-6-[(E)-[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]-4-methylbenzenesulfonate |
| SMILES | CCOc1cc(C)cc(/C=N/NC(=O)Cc2cccc(OC)c2)c1S(=O)(=O)Oc1ccccc1 |
| InChI | InChI=1S/C25H26N2O6S/c1-4-32-23-14-18(2)13-20(25(23)34(29,30)33-21-10-6-5-7-11-21)17-26-27-24(28)16-19-9-8-12-22(15-19)31-3/h5-15,17H,4,16H2,1-3H3,(H,27,28)/b26-17+ |
| InChIKey | KKIAWRKLNVTWJH-YZSQISJMSA-N |
| XLogP | 3.86 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|