C25H26N2O5S — CID 91017918
phenyl 2-[[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]-4-propylbenzenesulfonate (PubChem CID 91017918) has the molecular formula C25H26N2O5S and a molecular weight of 466.56 g/mol. Its IUPAC name is phenyl 2-[[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]-4-propylbenzenesulfonate.
| Compound Name | phenyl 2-[[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]-4-propylbenzenesulfonate |
|---|---|
| PubChem CID | 91017918 |
| Molecular Formula | C25H26N2O5S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | phenyl 2-[[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]-4-propylbenzenesulfonate |
| SMILES | CCCc1ccc(S(=O)(=O)Oc2ccccc2)c(C=NNC(=O)Cc2cccc(OC)c2)c1 |
| InChI | InChI=1S/C25H26N2O5S/c1-3-8-19-13-14-24(33(29,30)32-22-10-5-4-6-11-22)21(15-19)18-26-27-25(28)17-20-9-7-12-23(16-20)31-2/h4-7,9-16,18H,3,8,17H2,1-2H3,(H,27,28) |
| InChIKey | FGNCYNXBUGNXBK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|