C22H16ClF3N2O4S — CID 91478905
phenyl 2-[[[2-(3-chlorophenyl)acetyl]hydrazinylidene]methyl]-4-(trifluoromethyl)benzenesulfonate (PubChem CID 91478905) has the molecular formula C22H16ClF3N2O4S and a molecular weight of 496.89 g/mol. Its IUPAC name is phenyl 2-[[[2-(3-chlorophenyl)acetyl]hydrazinylidene]methyl]-4-(trifluoromethyl)benzenesulfonate.
| Compound Name | phenyl 2-[[[2-(3-chlorophenyl)acetyl]hydrazinylidene]methyl]-4-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 91478905 |
| Molecular Formula | C22H16ClF3N2O4S |
| Molecular Weight | 496.89 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | phenyl 2-[[[2-(3-chlorophenyl)acetyl]hydrazinylidene]methyl]-4-(trifluoromethyl)benzenesulfonate |
| SMILES | O=C(Cc1cccc(Cl)c1)NN=Cc1cc(C(F)(F)F)ccc1S(=O)(=O)Oc1ccccc1 |
| InChI | InChI=1S/C22H16ClF3N2O4S/c23-18-6-4-5-15(11-18)12-21(29)28-27-14-16-13-17(22(24,25)26)9-10-20(16)33(30,31)32-19-7-2-1-3-8-19/h1-11,13-14H,12H2,(H,28,29) |
| InChIKey | HILYPMCJNOKUCW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.89 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|