C29H23F3N2O5S — CID 73233933
[2-[[[2-(2-phenylmethoxyphenyl)acetyl]hydrazinylidene]methyl]phenyl] 4-(trifluoromethyl)benzenesulfonate (PubChem CID 73233933) has the molecular formula C29H23F3N2O5S and a molecular weight of 568.57 g/mol. Its IUPAC name is [2-[[[2-(2-phenylmethoxyphenyl)acetyl]hydrazinylidene]methyl]phenyl] 4-(trifluoromethyl)benzenesulfonate.
| Compound Name | [2-[[[2-(2-phenylmethoxyphenyl)acetyl]hydrazinylidene]methyl]phenyl] 4-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 73233933 |
| Molecular Formula | C29H23F3N2O5S |
| Molecular Weight | 568.57 g/mol |
| Exact Mass | 568.13 |
| IUPAC Name | [2-[[[2-(2-phenylmethoxyphenyl)acetyl]hydrazinylidene]methyl]phenyl] 4-(trifluoromethyl)benzenesulfonate |
| SMILES | O=C(Cc1ccccc1OCc1ccccc1)NN=Cc1ccccc1OS(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C29H23F3N2O5S/c30-29(31,32)24-14-16-25(17-15-24)40(36,37)39-27-13-7-5-11-23(27)19-33-34-28(35)18-22-10-4-6-12-26(22)38-20-21-8-2-1-3-9-21/h1-17,19H,18,20H2,(H,34,35) |
| InChIKey | DBVZRWHTHGQMDN-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.57 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|