C25H17F3N2O4S — CID 73233948
[2-[(naphthalene-1-carbonylhydrazinylidene)methyl]phenyl] 4-(trifluoromethyl)benzenesulfonate (PubChem CID 73233948) has the molecular formula C25H17F3N2O4S and a molecular weight of 498.48 g/mol. Its IUPAC name is [2-[(naphthalene-1-carbonylhydrazinylidene)methyl]phenyl] 4-(trifluoromethyl)benzenesulfonate.
| Compound Name | [2-[(naphthalene-1-carbonylhydrazinylidene)methyl]phenyl] 4-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 73233948 |
| Molecular Formula | C25H17F3N2O4S |
| Molecular Weight | 498.48 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | [2-[(naphthalene-1-carbonylhydrazinylidene)methyl]phenyl] 4-(trifluoromethyl)benzenesulfonate |
| SMILES | O=C(NN=Cc1ccccc1OS(=O)(=O)c1ccc(C(F)(F)F)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C25H17F3N2O4S/c26-25(27,28)19-12-14-20(15-13-19)35(32,33)34-23-11-4-2-7-18(23)16-29-30-24(31)22-10-5-8-17-6-1-3-9-21(17)22/h1-16H,(H,30,31) |
| InChIKey | DIWYGTSMRBPHTB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.48 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|