C20H14F3N3O4S — CID 73233953
[2-[(pyridine-3-carbonylhydrazinylidene)methyl]phenyl] 4-(trifluoromethyl)benzenesulfonate (PubChem CID 73233953) has the molecular formula C20H14F3N3O4S and a molecular weight of 449.41 g/mol. Its IUPAC name is [2-[(pyridine-3-carbonylhydrazinylidene)methyl]phenyl] 4-(trifluoromethyl)benzenesulfonate.
| Compound Name | [2-[(pyridine-3-carbonylhydrazinylidene)methyl]phenyl] 4-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 73233953 |
| Molecular Formula | C20H14F3N3O4S |
| Molecular Weight | 449.41 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | [2-[(pyridine-3-carbonylhydrazinylidene)methyl]phenyl] 4-(trifluoromethyl)benzenesulfonate |
| SMILES | O=C(NN=Cc1ccccc1OS(=O)(=O)c1ccc(C(F)(F)F)cc1)c1cccnc1 |
| InChI | InChI=1S/C20H14F3N3O4S/c21-20(22,23)16-7-9-17(10-8-16)31(28,29)30-18-6-2-1-4-14(18)13-25-26-19(27)15-5-3-11-24-12-15/h1-13H,(H,26,27) |
| InChIKey | FBTVXHXZIIJDNH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|