C24H18F3N3O4S — CID 73233881
[2-[[[2-(1H-indol-3-yl)acetyl]hydrazinylidene]methyl]phenyl] 4-(trifluoromethyl)benzenesulfonate (PubChem CID 73233881) has the molecular formula C24H18F3N3O4S and a molecular weight of 501.49 g/mol. Its IUPAC name is [2-[[[2-(1H-indol-3-yl)acetyl]hydrazinylidene]methyl]phenyl] 4-(trifluoromethyl)benzenesulfonate.
| Compound Name | [2-[[[2-(1H-indol-3-yl)acetyl]hydrazinylidene]methyl]phenyl] 4-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 73233881 |
| Molecular Formula | C24H18F3N3O4S |
| Molecular Weight | 501.49 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | [2-[[[2-(1H-indol-3-yl)acetyl]hydrazinylidene]methyl]phenyl] 4-(trifluoromethyl)benzenesulfonate |
| SMILES | O=C(Cc1c[nH]c2ccccc12)NN=Cc1ccccc1OS(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H18F3N3O4S/c25-24(26,27)18-9-11-19(12-10-18)35(32,33)34-22-8-4-1-5-16(22)15-29-30-23(31)13-17-14-28-21-7-3-2-6-20(17)21/h1-12,14-15,28H,13H2,(H,30,31) |
| InChIKey | CJKBRNPBWYZSQR-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|