C21H17N3O6S — CID 3127361
[2-[[[2-(4-nitrophenyl)acetyl]hydrazinylidene]methyl]phenyl] benzenesulfonate (PubChem CID 3127361) has the molecular formula C21H17N3O6S and a molecular weight of 439.45 g/mol. Its IUPAC name is [2-[[[2-(4-nitrophenyl)acetyl]hydrazinylidene]methyl]phenyl] benzenesulfonate.
| Compound Name | [2-[[[2-(4-nitrophenyl)acetyl]hydrazinylidene]methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 3127361 |
| Molecular Formula | C21H17N3O6S |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | [2-[[[2-(4-nitrophenyl)acetyl]hydrazinylidene]methyl]phenyl] benzenesulfonate |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)NN=Cc1ccccc1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H17N3O6S/c25-21(14-16-10-12-18(13-11-16)24(26)27)23-22-15-17-6-4-5-9-20(17)30-31(28,29)19-7-2-1-3-8-19/h1-13,15H,14H2,(H,23,25) |
| InChIKey | ALWYXWYQSISEPP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 127.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|