C28H24N2O6S — CID 73234068
[2-[[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]phenyl] 4-phenoxybenzenesulfonate (PubChem CID 73234068) has the molecular formula C28H24N2O6S and a molecular weight of 516.58 g/mol. Its IUPAC name is [2-[[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]phenyl] 4-phenoxybenzenesulfonate.
| Compound Name | [2-[[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]phenyl] 4-phenoxybenzenesulfonate |
|---|---|
| PubChem CID | 73234068 |
| Molecular Formula | C28H24N2O6S |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | [2-[[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]phenyl] 4-phenoxybenzenesulfonate |
| SMILES | COc1cccc(CC(=O)NN=Cc2ccccc2OS(=O)(=O)c2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C28H24N2O6S/c1-34-25-12-7-8-21(18-25)19-28(31)30-29-20-22-9-5-6-13-27(22)36-37(32,33)26-16-14-24(15-17-26)35-23-10-3-2-4-11-23/h2-18,20H,19H2,1H3,(H,30,31) |
| InChIKey | YWAIMIKDVYNMFT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|