C23H19N3O6S2 — CID 73234077
[2-[[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]phenyl] 5-(1,3-oxazol-5-yl)thiophene-2-sulfonate (PubChem CID 73234077) has the molecular formula C23H19N3O6S2 and a molecular weight of 497.55 g/mol. Its IUPAC name is [2-[[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]phenyl] 5-(1,3-oxazol-5-yl)thiophene-2-sulfonate.
| Compound Name | [2-[[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]phenyl] 5-(1,3-oxazol-5-yl)thiophene-2-sulfonate |
|---|---|
| PubChem CID | 73234077 |
| Molecular Formula | C23H19N3O6S2 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | [2-[[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]phenyl] 5-(1,3-oxazol-5-yl)thiophene-2-sulfonate |
| SMILES | COc1cccc(CC(=O)NN=Cc2ccccc2OS(=O)(=O)c2ccc(-c3cnco3)s2)c1 |
| InChI | InChI=1S/C23H19N3O6S2/c1-30-18-7-4-5-16(11-18)12-22(27)26-25-13-17-6-2-3-8-19(17)32-34(28,29)23-10-9-21(33-23)20-14-24-15-31-20/h2-11,13-15H,12H2,1H3,(H,26,27) |
| InChIKey | CGQAWUAYSTWKGB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|