C20H16Cl2N2O5S2 — CID 73234064
[2-[[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]phenyl] 2,5-dichlorothiophene-3-sulfonate (PubChem CID 73234064) has the molecular formula C20H16Cl2N2O5S2 and a molecular weight of 499.40 g/mol. Its IUPAC name is [2-[[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]phenyl] 2,5-dichlorothiophene-3-sulfonate.
| Compound Name | [2-[[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]phenyl] 2,5-dichlorothiophene-3-sulfonate |
|---|---|
| PubChem CID | 73234064 |
| Molecular Formula | C20H16Cl2N2O5S2 |
| Molecular Weight | 499.40 g/mol |
| Exact Mass | 497.99 |
| IUPAC Name | [2-[[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]phenyl] 2,5-dichlorothiophene-3-sulfonate |
| SMILES | COc1cccc(CC(=O)NN=Cc2ccccc2OS(=O)(=O)c2cc(Cl)sc2Cl)c1 |
| InChI | InChI=1S/C20H16Cl2N2O5S2/c1-28-15-7-4-5-13(9-15)10-19(25)24-23-12-14-6-2-3-8-16(14)29-31(26,27)17-11-18(21)30-20(17)22/h2-9,11-12H,10H2,1H3,(H,24,25) |
| InChIKey | WQGUDWBLJHLHBP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|