C26H28N2O6S — CID 90939000
phenyl 4-butoxy-2-[[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]benzenesulfonate (PubChem CID 90939000) has the molecular formula C26H28N2O6S and a molecular weight of 496.59 g/mol. Its IUPAC name is phenyl 4-butoxy-2-[[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]benzenesulfonate.
| Compound Name | phenyl 4-butoxy-2-[[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]benzenesulfonate |
|---|---|
| PubChem CID | 90939000 |
| Molecular Formula | C26H28N2O6S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | phenyl 4-butoxy-2-[[[2-(3-methoxyphenyl)acetyl]hydrazinylidene]methyl]benzenesulfonate |
| SMILES | CCCCOc1ccc(S(=O)(=O)Oc2ccccc2)c(C=NNC(=O)Cc2cccc(OC)c2)c1 |
| InChI | InChI=1S/C26H28N2O6S/c1-3-4-15-33-24-13-14-25(35(30,31)34-22-10-6-5-7-11-22)21(18-24)19-27-28-26(29)17-20-9-8-12-23(16-20)32-2/h5-14,16,18-19H,3-4,15,17H2,1-2H3,(H,28,29) |
| InChIKey | BDGXKGJQIOVMKC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|