C24H21F3N2O6S — CID 87983423
phenyl 2-[(E)-[[2-(2,4-dimethoxyphenyl)acetyl]hydrazinylidene]methyl]-4-(trifluoromethyl)benzenesulfonate (PubChem CID 87983423) has the molecular formula C24H21F3N2O6S and a molecular weight of 522.50 g/mol. Its IUPAC name is phenyl 2-[(E)-[[2-(2,4-dimethoxyphenyl)acetyl]hydrazinylidene]methyl]-4-(trifluoromethyl)benzenesulfonate.
| Compound Name | phenyl 2-[(E)-[[2-(2,4-dimethoxyphenyl)acetyl]hydrazinylidene]methyl]-4-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 87983423 |
| Molecular Formula | C24H21F3N2O6S |
| Molecular Weight | 522.50 g/mol |
| Exact Mass | 522.11 |
| IUPAC Name | phenyl 2-[(E)-[[2-(2,4-dimethoxyphenyl)acetyl]hydrazinylidene]methyl]-4-(trifluoromethyl)benzenesulfonate |
| SMILES | COc1ccc(CC(=O)N/N=C/c2cc(C(F)(F)F)ccc2S(=O)(=O)Oc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C24H21F3N2O6S/c1-33-20-10-8-16(21(14-20)34-2)13-23(30)29-28-15-17-12-18(24(25,26)27)9-11-22(17)36(31,32)35-19-6-4-3-5-7-19/h3-12,14-15H,13H2,1-2H3,(H,29,30)/b28-15+ |
| InChIKey | PWKUDUFDHMXIMT-RWPZCVJISA-N |
| XLogP | 4.18 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|