C25H23F3N2O7S — CID 90984017
phenyl 4-(trifluoromethyl)-2-[[[2-(3,4,5-trimethoxyphenyl)acetyl]hydrazinylidene]methyl]benzenesulfonate (PubChem CID 90984017) has the molecular formula C25H23F3N2O7S and a molecular weight of 552.53 g/mol. Its IUPAC name is phenyl 4-(trifluoromethyl)-2-[[[2-(3,4,5-trimethoxyphenyl)acetyl]hydrazinylidene]methyl]benzenesulfonate.
| Compound Name | phenyl 4-(trifluoromethyl)-2-[[[2-(3,4,5-trimethoxyphenyl)acetyl]hydrazinylidene]methyl]benzenesulfonate |
|---|---|
| PubChem CID | 90984017 |
| Molecular Formula | C25H23F3N2O7S |
| Molecular Weight | 552.53 g/mol |
| Exact Mass | 552.12 |
| IUPAC Name | phenyl 4-(trifluoromethyl)-2-[[[2-(3,4,5-trimethoxyphenyl)acetyl]hydrazinylidene]methyl]benzenesulfonate |
| SMILES | COc1cc(CC(=O)NN=Cc2cc(C(F)(F)F)ccc2S(=O)(=O)Oc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H23F3N2O7S/c1-34-20-11-16(12-21(35-2)24(20)36-3)13-23(31)30-29-15-17-14-18(25(26,27)28)9-10-22(17)38(32,33)37-19-7-5-4-6-8-19/h4-12,14-15H,13H2,1-3H3,(H,30,31) |
| InChIKey | XSVQRYURSQLODB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|