C22H14Cl3F3N2O4S — CID 87983455
phenyl 2-[(E)-[[2-(2,3,6-trichlorophenyl)acetyl]hydrazinylidene]methyl]-4-(trifluoromethyl)benzenesulfonate (PubChem CID 87983455) has the molecular formula C22H14Cl3F3N2O4S and a molecular weight of 565.78 g/mol. Its IUPAC name is phenyl 2-[(E)-[[2-(2,3,6-trichlorophenyl)acetyl]hydrazinylidene]methyl]-4-(trifluoromethyl)benzenesulfonate.
| Compound Name | phenyl 2-[(E)-[[2-(2,3,6-trichlorophenyl)acetyl]hydrazinylidene]methyl]-4-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 87983455 |
| Molecular Formula | C22H14Cl3F3N2O4S |
| Molecular Weight | 565.78 g/mol |
| Exact Mass | 563.97 |
| IUPAC Name | phenyl 2-[(E)-[[2-(2,3,6-trichlorophenyl)acetyl]hydrazinylidene]methyl]-4-(trifluoromethyl)benzenesulfonate |
| SMILES | O=C(Cc1c(Cl)ccc(Cl)c1Cl)N/N=C/c1cc(C(F)(F)F)ccc1S(=O)(=O)Oc1ccccc1 |
| InChI | InChI=1S/C22H14Cl3F3N2O4S/c23-17-7-8-18(24)21(25)16(17)11-20(31)30-29-12-13-10-14(22(26,27)28)6-9-19(13)35(32,33)34-15-4-2-1-3-5-15/h1-10,12H,11H2,(H,30,31)/b29-12+ |
| InChIKey | ARBDIQUZJHTBIS-XKJRVUDJSA-N |
| XLogP | 6.13 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.78 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|