C22H15ClF3N2O4S- — CID 154393178
2-[2-[[[2-(3-chlorophenyl)acetyl]hydrazinylidene]methyl]phenyl]-4-(trifluoromethyl)benzenesulfonate (PubChem CID 154393178) has the molecular formula C22H15ClF3N2O4S- and a molecular weight of 495.89 g/mol. Its IUPAC name is 2-[2-[[[2-(3-chlorophenyl)acetyl]hydrazinylidene]methyl]phenyl]-4-(trifluoromethyl)benzenesulfonate.
| Compound Name | 2-[2-[[[2-(3-chlorophenyl)acetyl]hydrazinylidene]methyl]phenyl]-4-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 154393178 |
| Molecular Formula | C22H15ClF3N2O4S- |
| Molecular Weight | 495.89 g/mol |
| Exact Mass | 495.04 |
| IUPAC Name | 2-[2-[[[2-(3-chlorophenyl)acetyl]hydrazinylidene]methyl]phenyl]-4-(trifluoromethyl)benzenesulfonate |
| SMILES | O=C(Cc1cccc(Cl)c1)NN=Cc1ccccc1-c1cc(C(F)(F)F)ccc1S(=O)(=O)[O-] |
| InChI | InChI=1S/C22H16ClF3N2O4S/c23-17-6-3-4-14(10-17)11-21(29)28-27-13-15-5-1-2-7-18(15)19-12-16(22(24,25)26)8-9-20(19)33(30,31)32/h1-10,12-13H,11H2,(H,28,29)(H,30,31,32)/p-1 |
| InChIKey | CHCSWFGDKHZLAZ-UHFFFAOYSA-M |
| XLogP | 4.62 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.89 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|