C22H15Cl2F3N2O4S — CID 173189452
3-chloro-2-[2-[[[2-(3-chlorophenyl)acetyl]hydrazinylidene]methyl]phenyl]-4-(trifluoromethyl)benzenesulfonic acid (PubChem CID 173189452) has the molecular formula C22H15Cl2F3N2O4S and a molecular weight of 531.34 g/mol. Its IUPAC name is 3-chloro-2-[2-[[[2-(3-chlorophenyl)acetyl]hydrazinylidene]methyl]phenyl]-4-(trifluoromethyl)benzenesulfonic acid.
| Compound Name | 3-chloro-2-[2-[[[2-(3-chlorophenyl)acetyl]hydrazinylidene]methyl]phenyl]-4-(trifluoromethyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 173189452 |
| Molecular Formula | C22H15Cl2F3N2O4S |
| Molecular Weight | 531.34 g/mol |
| Exact Mass | 530.01 |
| IUPAC Name | 3-chloro-2-[2-[[[2-(3-chlorophenyl)acetyl]hydrazinylidene]methyl]phenyl]-4-(trifluoromethyl)benzenesulfonic acid |
| SMILES | O=C(Cc1cccc(Cl)c1)NN=Cc1ccccc1-c1c(S(=O)(=O)O)ccc(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C22H15Cl2F3N2O4S/c23-15-6-3-4-13(10-15)11-19(30)29-28-12-14-5-1-2-7-16(14)20-18(34(31,32)33)9-8-17(21(20)24)22(25,26)27/h1-10,12H,11H2,(H,29,30)(H,31,32,33) |
| InChIKey | CACZBUCTWFEKIK-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.34 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|