C21H17F3N2O5S — CID 173189460
2-[2-[[3-(furan-2-yl)propanoylhydrazinylidene]methyl]phenyl]-4-(trifluoromethyl)benzenesulfonic acid (PubChem CID 173189460) has the molecular formula C21H17F3N2O5S and a molecular weight of 466.44 g/mol. Its IUPAC name is 2-[2-[[3-(furan-2-yl)propanoylhydrazinylidene]methyl]phenyl]-4-(trifluoromethyl)benzenesulfonic acid.
| Compound Name | 2-[2-[[3-(furan-2-yl)propanoylhydrazinylidene]methyl]phenyl]-4-(trifluoromethyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 173189460 |
| Molecular Formula | C21H17F3N2O5S |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | 2-[2-[[3-(furan-2-yl)propanoylhydrazinylidene]methyl]phenyl]-4-(trifluoromethyl)benzenesulfonic acid |
| SMILES | O=C(CCc1ccco1)NN=Cc1ccccc1-c1cc(C(F)(F)F)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C21H17F3N2O5S/c22-21(23,24)15-7-9-19(32(28,29)30)18(12-15)17-6-2-1-4-14(17)13-25-26-20(27)10-8-16-5-3-11-31-16/h1-7,9,11-13H,8,10H2,(H,26,27)(H,28,29,30) |
| InChIKey | YVNAUAGVDFVSRZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 108.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|