C15H14N4NaO7S2+ — CID 54605533
sodium 2-[(E)-[[(Z)-(2-sulfophenyl)methylideneamino]carbamoylhydrazinylidene]methyl]benzenesulfonic acid (PubChem CID 54605533) has the molecular formula C15H14N4NaO7S2+ and a molecular weight of 449.42 g/mol. Its IUPAC name is sodium 2-[(E)-[[(Z)-(2-sulfophenyl)methylideneamino]carbamoylhydrazinylidene]methyl]benzenesulfonic acid.
| Compound Name | sodium 2-[(E)-[[(Z)-(2-sulfophenyl)methylideneamino]carbamoylhydrazinylidene]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 54605533 |
| Molecular Formula | C15H14N4NaO7S2+ |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | sodium 2-[(E)-[[(Z)-(2-sulfophenyl)methylideneamino]carbamoylhydrazinylidene]methyl]benzenesulfonic acid |
| SMILES | O=C(N/N=C\c1ccccc1S(=O)(=O)O)N/N=C/c1ccccc1S(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C15H14N4O7S2.Na/c20-15(18-16-9-11-5-1-3-7-13(11)27(21,22)23)19-17-10-12-6-2-4-8-14(12)28(24,25)26;/h1-10H,(H2,18,19,20)(H,21,22,23)(H,24,25,26);/q;+1/b16-9-,17-10+; |
| InChIKey | GQHXRESWNMWYNV-CCLJVFRUSA-N |
| XLogP | -2.15 |
| TPSA | 174.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|