C12H15N3O6S — CID 102349331
2-[(Z)-[[(2R)-2-acetamido-3-hydroxypropanoyl]hydrazinylidene]methyl]benzenesulfonic acid (PubChem CID 102349331) has the molecular formula C12H15N3O6S and a molecular weight of 329.33 g/mol. Its IUPAC name is 2-[(Z)-[[(2R)-2-acetamido-3-hydroxypropanoyl]hydrazinylidene]methyl]benzenesulfonic acid.
| Compound Name | 2-[(Z)-[[(2R)-2-acetamido-3-hydroxypropanoyl]hydrazinylidene]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 102349331 |
| Molecular Formula | C12H15N3O6S |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 2-[(Z)-[[(2R)-2-acetamido-3-hydroxypropanoyl]hydrazinylidene]methyl]benzenesulfonic acid |
| SMILES | CC(=O)N[C@H](CO)C(=O)N/N=C\c1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C12H15N3O6S/c1-8(17)14-10(7-16)12(18)15-13-6-9-4-2-3-5-11(9)22(19,20)21/h2-6,10,16H,7H2,1H3,(H,14,17)(H,15,18)(H,19,20,21)/b13-6-/t10-/m1/s1 |
| InChIKey | UKPNFTFSLRDLLO-YRVKEHPISA-N |
| XLogP | -1.12 |
| TPSA | 145.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|