C14H12N2O5S — CID 88896863
3-[(2E)-2-[(2-sulfophenyl)methylidene]hydrazinyl]benzoic acid (PubChem CID 88896863) has the molecular formula C14H12N2O5S and a molecular weight of 320.33 g/mol. Its IUPAC name is 3-[(2E)-2-[(2-sulfophenyl)methylidene]hydrazinyl]benzoic acid.
| Compound Name | 3-[(2E)-2-[(2-sulfophenyl)methylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 88896863 |
| Molecular Formula | C14H12N2O5S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 3-[(2E)-2-[(2-sulfophenyl)methylidene]hydrazinyl]benzoic acid |
| SMILES | O=C(O)c1cccc(N/N=C/c2ccccc2S(=O)(=O)O)c1 |
| InChI | InChI=1S/C14H12N2O5S/c17-14(18)10-5-3-6-12(8-10)16-15-9-11-4-1-2-7-13(11)22(19,20)21/h1-9,16H,(H,17,18)(H,19,20,21)/b15-9+ |
| InChIKey | XIJHZEOXLHOYNA-OQLLNIDSSA-N |
| XLogP | 2.08 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|