C15H17N3O3S — CID 163698538
2-[[[4-(dimethylamino)phenyl]hydrazinylidene]methyl]benzenesulfonic acid (PubChem CID 163698538) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is 2-[[[4-(dimethylamino)phenyl]hydrazinylidene]methyl]benzenesulfonic acid.
| Compound Name | 2-[[[4-(dimethylamino)phenyl]hydrazinylidene]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 163698538 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 2-[[[4-(dimethylamino)phenyl]hydrazinylidene]methyl]benzenesulfonic acid |
| SMILES | CN(C)c1ccc(NN=Cc2ccccc2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C15H17N3O3S/c1-18(2)14-9-7-13(8-10-14)17-16-11-12-5-3-4-6-15(12)22(19,20)21/h3-11,17H,1-2H3,(H,19,20,21) |
| InChIKey | JYYVJNJCZYXLQC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|