C9H10N2O4S — CID 6113992
2-[(Z)-(acetylhydrazinylidene)methyl]benzenesulfonic acid (PubChem CID 6113992) has the molecular formula C9H10N2O4S and a molecular weight of 242.26 g/mol. Its IUPAC name is 2-[(Z)-(acetylhydrazinylidene)methyl]benzenesulfonic acid.
| Compound Name | 2-[(Z)-(acetylhydrazinylidene)methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 6113992 |
| Molecular Formula | C9H10N2O4S |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 2-[(Z)-(acetylhydrazinylidene)methyl]benzenesulfonic acid |
| SMILES | CC(=O)N/N=C\c1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C9H10N2O4S/c1-7(12)11-10-6-8-4-2-3-5-9(8)16(13,14)15/h2-6H,1H3,(H,11,12)(H,13,14,15)/b10-6- |
| InChIKey | MVJGVVZNHIEITL-POHAHGRESA-N |
| XLogP | 0.40 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|