C8H10N4O4S — CID 173023985
2-[(E)-[[amino-(hydroxyamino)methylidene]hydrazinylidene]methyl]benzenesulfonic acid (PubChem CID 173023985) has the molecular formula C8H10N4O4S and a molecular weight of 258.26 g/mol. Its IUPAC name is 2-[(E)-[[amino-(hydroxyamino)methylidene]hydrazinylidene]methyl]benzenesulfonic acid.
| Compound Name | 2-[(E)-[[amino-(hydroxyamino)methylidene]hydrazinylidene]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 173023985 |
| Molecular Formula | C8H10N4O4S |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 2-[(E)-[[amino-(hydroxyamino)methylidene]hydrazinylidene]methyl]benzenesulfonic acid |
| SMILES | NC(=N/N=C/c1ccccc1S(=O)(=O)O)NO |
| InChI | InChI=1S/C8H10N4O4S/c9-8(12-13)11-10-5-6-3-1-2-4-7(6)17(14,15)16/h1-5,13H,(H3,9,11,12)(H,14,15,16)/b10-5+ |
| InChIKey | CKYXSRSOIDOXSJ-BJMVGYQFSA-N |
| XLogP | -0.44 |
| TPSA | 137.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|