C8H9Cl3N4O — CID 172915821
2-[(E)-(2,6-dichlorophenyl)methylideneamino]-1-hydroxyguanidine;hydrochloride (PubChem CID 172915821) has the molecular formula C8H9Cl3N4O and a molecular weight of 283.55 g/mol. Its IUPAC name is 2-[(E)-(2,6-dichlorophenyl)methylideneamino]-1-hydroxyguanidine;hydrochloride.
| Compound Name | 2-[(E)-(2,6-dichlorophenyl)methylideneamino]-1-hydroxyguanidine;hydrochloride |
|---|---|
| PubChem CID | 172915821 |
| Molecular Formula | C8H9Cl3N4O |
| Molecular Weight | 283.55 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | 2-[(E)-(2,6-dichlorophenyl)methylideneamino]-1-hydroxyguanidine;hydrochloride |
| SMILES | Cl.NC(=N/N=C/c1c(Cl)cccc1Cl)NO |
| InChI | InChI=1S/C8H8Cl2N4O.ClH/c9-6-2-1-3-7(10)5(6)4-12-13-8(11)14-15;/h1-4,15H,(H3,11,13,14);1H/b12-4+; |
| InChIKey | PQPZROSFRCBPIM-AQCBZIOHSA-N |
| XLogP | 2.04 |
| TPSA | 83.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.55 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|