C8H9ClN4O — CID 173023950
2-[(E)-(4-chlorophenyl)methylideneamino]-1-hydroxyguanidine (PubChem CID 173023950) has the molecular formula C8H9ClN4O and a molecular weight of 212.64 g/mol. Its IUPAC name is 2-[(E)-(4-chlorophenyl)methylideneamino]-1-hydroxyguanidine.
| Compound Name | 2-[(E)-(4-chlorophenyl)methylideneamino]-1-hydroxyguanidine |
|---|---|
| PubChem CID | 173023950 |
| Molecular Formula | C8H9ClN4O |
| Molecular Weight | 212.64 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 2-[(E)-(4-chlorophenyl)methylideneamino]-1-hydroxyguanidine |
| SMILES | NC(=N/N=C/c1ccc(Cl)cc1)NO |
| InChI | InChI=1S/C8H9ClN4O/c9-7-3-1-6(2-4-7)5-11-12-8(10)13-14/h1-5,14H,(H3,10,12,13)/b11-5+ |
| InChIKey | ZWVAPQNEIBUJSS-VZUCSPMQSA-N |
| XLogP | 0.97 |
| TPSA | 83.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.64 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|