C8H8F2N4O — CID 173024102
2-[(E)-(3,4-difluorophenyl)methylideneamino]-1-hydroxyguanidine (PubChem CID 173024102) has the molecular formula C8H8F2N4O and a molecular weight of 214.18 g/mol. Its IUPAC name is 2-[(E)-(3,4-difluorophenyl)methylideneamino]-1-hydroxyguanidine.
| Compound Name | 2-[(E)-(3,4-difluorophenyl)methylideneamino]-1-hydroxyguanidine |
|---|---|
| PubChem CID | 173024102 |
| Molecular Formula | C8H8F2N4O |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 2-[(E)-(3,4-difluorophenyl)methylideneamino]-1-hydroxyguanidine |
| SMILES | NC(=N/N=C/c1ccc(F)c(F)c1)NO |
| InChI | InChI=1S/C8H8F2N4O/c9-6-2-1-5(3-7(6)10)4-12-13-8(11)14-15/h1-4,15H,(H3,11,13,14)/b12-4+ |
| InChIKey | SCOPVKOMYHNLAS-UUILKARUSA-N |
| XLogP | 0.59 |
| TPSA | 83.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|