C8H8BrFN4O — CID 139982870
2-[(E)-(4-bromo-2-fluorophenyl)methylideneamino]-1-hydroxyguanidine (PubChem CID 139982870) has the molecular formula C8H8BrFN4O and a molecular weight of 275.08 g/mol. Its IUPAC name is 2-[(E)-(4-bromo-2-fluorophenyl)methylideneamino]-1-hydroxyguanidine.
| Compound Name | 2-[(E)-(4-bromo-2-fluorophenyl)methylideneamino]-1-hydroxyguanidine |
|---|---|
| PubChem CID | 139982870 |
| Molecular Formula | C8H8BrFN4O |
| Molecular Weight | 275.08 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | 2-[(E)-(4-bromo-2-fluorophenyl)methylideneamino]-1-hydroxyguanidine |
| SMILES | N/C(=N\N=C\c1ccc(Br)cc1F)NO |
| InChI | InChI=1S/C8H8BrFN4O/c9-6-2-1-5(7(10)3-6)4-12-13-8(11)14-15/h1-4,15H,(H3,11,13,14)/b12-4+ |
| InChIKey | ZSIQTAPKSPPLOP-UUILKARUSA-N |
| XLogP | 1.22 |
| TPSA | 83.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.08 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|