C8H8Br2N4O2 — CID 135435056
2-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-1-hydroxyguanidine (PubChem CID 135435056) has the molecular formula C8H8Br2N4O2 and a molecular weight of 351.99 g/mol. Its IUPAC name is 2-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-1-hydroxyguanidine.
| Compound Name | 2-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-1-hydroxyguanidine |
|---|---|
| PubChem CID | 135435056 |
| Molecular Formula | C8H8Br2N4O2 |
| Molecular Weight | 351.99 g/mol |
| Exact Mass | 349.90 |
| IUPAC Name | 2-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-1-hydroxyguanidine |
| SMILES | N/C(=N\N=C\c1cc(Br)cc(Br)c1O)NO |
| InChI | InChI=1S/C8H8Br2N4O2/c9-5-1-4(7(15)6(10)2-5)3-12-13-8(11)14-16/h1-3,15-16H,(H3,11,13,14)/b12-3+ |
| InChIKey | RVXULOSKNOTEBK-KGVSQERTSA-N |
| XLogP | 1.54 |
| TPSA | 103.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.99 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|