C11H15BrN4O4 — CID 173023877
2-[(E)-(5-bromo-2,3,4-trimethoxyphenyl)methylideneamino]-1-hydroxyguanidine (PubChem CID 173023877) has the molecular formula C11H15BrN4O4 and a molecular weight of 347.17 g/mol. Its IUPAC name is 2-[(E)-(5-bromo-2,3,4-trimethoxyphenyl)methylideneamino]-1-hydroxyguanidine.
| Compound Name | 2-[(E)-(5-bromo-2,3,4-trimethoxyphenyl)methylideneamino]-1-hydroxyguanidine |
|---|---|
| PubChem CID | 173023877 |
| Molecular Formula | C11H15BrN4O4 |
| Molecular Weight | 347.17 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 2-[(E)-(5-bromo-2,3,4-trimethoxyphenyl)methylideneamino]-1-hydroxyguanidine |
| SMILES | COc1c(Br)cc(/C=N/N=C(N)NO)c(OC)c1OC |
| InChI | InChI=1S/C11H15BrN4O4/c1-18-8-6(5-14-15-11(13)16-17)4-7(12)9(19-2)10(8)20-3/h4-5,17H,1-3H3,(H3,13,15,16)/b14-5+ |
| InChIKey | MBPRMGJACYKXTC-LHHJGKSTSA-N |
| XLogP | 1.10 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.17 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|