C11H15ClN4O4 — CID 142660061
2-[(2-chloro-3,4,5-trimethoxyphenyl)methylideneamino]-1-hydroxyguanidine (PubChem CID 142660061) has the molecular formula C11H15ClN4O4 and a molecular weight of 302.72 g/mol. Its IUPAC name is 2-[(2-chloro-3,4,5-trimethoxyphenyl)methylideneamino]-1-hydroxyguanidine.
| Compound Name | 2-[(2-chloro-3,4,5-trimethoxyphenyl)methylideneamino]-1-hydroxyguanidine |
|---|---|
| PubChem CID | 142660061 |
| Molecular Formula | C11H15ClN4O4 |
| Molecular Weight | 302.72 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2-[(2-chloro-3,4,5-trimethoxyphenyl)methylideneamino]-1-hydroxyguanidine |
| SMILES | COc1cc(C=N/N=C(/N)NO)c(Cl)c(OC)c1OC |
| InChI | InChI=1S/C11H15ClN4O4/c1-18-7-4-6(5-14-15-11(13)16-17)8(12)10(20-3)9(7)19-2/h4-5,17H,1-3H3,(H3,13,15,16) |
| InChIKey | NFEZARIWTRCHQR-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.72 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|