C10H12ClN5O5 — CID 10300026
2-[(E)-(2-chloro-3,4-dimethoxy-6-nitrophenyl)methylideneamino]-1-hydroxyguanidine (PubChem CID 10300026) has the molecular formula C10H12ClN5O5 and a molecular weight of 317.69 g/mol. Its IUPAC name is 2-[(E)-(2-chloro-3,4-dimethoxy-6-nitrophenyl)methylideneamino]-1-hydroxyguanidine.
| Compound Name | 2-[(E)-(2-chloro-3,4-dimethoxy-6-nitrophenyl)methylideneamino]-1-hydroxyguanidine |
|---|---|
| PubChem CID | 10300026 |
| Molecular Formula | C10H12ClN5O5 |
| Molecular Weight | 317.69 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 2-[(E)-(2-chloro-3,4-dimethoxy-6-nitrophenyl)methylideneamino]-1-hydroxyguanidine |
| SMILES | COc1cc([N+](=O)[O-])c(/C=N/N=C(/N)NO)c(Cl)c1OC |
| InChI | InChI=1S/C10H12ClN5O5/c1-20-7-3-6(16(18)19)5(8(11)9(7)21-2)4-13-14-10(12)15-17/h3-4,17H,1-2H3,(H3,12,14,15)/b13-4+ |
| InChIKey | BRFPNDJUXCECRE-YIXHJXPBSA-N |
| XLogP | 0.89 |
| TPSA | 144.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.69 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|