C9H10N6O5 — CID 85064349
2-[(3-methoxy-2,6-dinitrophenyl)methylideneamino]guanidine (PubChem CID 85064349) has the molecular formula C9H10N6O5 and a molecular weight of 282.22 g/mol. Its IUPAC name is 2-[(3-methoxy-2,6-dinitrophenyl)methylideneamino]guanidine.
| Compound Name | 2-[(3-methoxy-2,6-dinitrophenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 85064349 |
| Molecular Formula | C9H10N6O5 |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 2-[(3-methoxy-2,6-dinitrophenyl)methylideneamino]guanidine |
| SMILES | COc1ccc([N+](=O)[O-])c(C=NN=C(N)N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H10N6O5/c1-20-7-3-2-6(14(16)17)5(8(7)15(18)19)4-12-13-9(10)11/h2-4H,1H3,(H4,10,11,13) |
| InChIKey | CAOAXWGDINBGIG-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 172.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|