C9H11N3O4 — CID 168531252
(3,6-dimethoxy-2-nitrophenyl)methylidenehydrazine (PubChem CID 168531252) has the molecular formula C9H11N3O4 and a molecular weight of 225.20 g/mol. Its IUPAC name is (3,6-dimethoxy-2-nitrophenyl)methylidenehydrazine.
| Compound Name | (3,6-dimethoxy-2-nitrophenyl)methylidenehydrazine |
|---|---|
| PubChem CID | 168531252 |
| Molecular Formula | C9H11N3O4 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | (3,6-dimethoxy-2-nitrophenyl)methylidenehydrazine |
| SMILES | COc1ccc(OC)c([N+](=O)[O-])c1C=NN |
| InChI | InChI=1S/C9H11N3O4/c1-15-7-3-4-8(16-2)9(12(13)14)6(7)5-11-10/h3-5H,10H2,1-2H3 |
| InChIKey | WGIAIXOPEKJXRE-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 99.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|