C10H8N2O7 — CID 3835991
3-(3-methoxy-2,6-dinitrophenyl)prop-2-enoic acid (PubChem CID 3835991) has the molecular formula C10H8N2O7 and a molecular weight of 268.18 g/mol. Its IUPAC name is 3-(3-methoxy-2,6-dinitrophenyl)prop-2-enoic acid.
| Compound Name | 3-(3-methoxy-2,6-dinitrophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 3835991 |
| Molecular Formula | C10H8N2O7 |
| Molecular Weight | 268.18 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 3-(3-methoxy-2,6-dinitrophenyl)prop-2-enoic acid |
| SMILES | COc1ccc([N+](=O)[O-])c(C=CC(=O)O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H8N2O7/c1-19-8-4-3-7(11(15)16)6(2-5-9(13)14)10(8)12(17)18/h2-5H,1H3,(H,13,14) |
| InChIKey | FHIDLXBMMTXNMM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 132.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.18 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|