C12H6N4O12 — CID 126715279
(E)-3-[4-[(E)-2-carboxyethenyl]-2,3,5,6-tetranitrophenyl]prop-2-enoic acid (PubChem CID 126715279) has the molecular formula C12H6N4O12 and a molecular weight of 398.20 g/mol. Its IUPAC name is (E)-3-[4-[(E)-2-carboxyethenyl]-2,3,5,6-tetranitrophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-2-carboxyethenyl]-2,3,5,6-tetranitrophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 126715279 |
| Molecular Formula | C12H6N4O12 |
| Molecular Weight | 398.20 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | (E)-3-[4-[(E)-2-carboxyethenyl]-2,3,5,6-tetranitrophenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1c([N+](=O)[O-])c([N+](=O)[O-])c(/C=C/C(=O)O)c([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H6N4O12/c17-7(18)3-1-5-9(13(21)22)11(15(25)26)6(2-4-8(19)20)12(16(27)28)10(5)14(23)24/h1-4H,(H,17,18)(H,19,20)/b3-1+,4-2+ |
| InChIKey | KXXIGARQBNITNL-ZPUQHVIOSA-N |
| XLogP | 1.51 |
| TPSA | 247.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.20 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|