About (E)-but-2-enedioic acid;bis(nitric acid)
(E)-but-2-enedioic acid;bis(nitric acid) (PubChem CID 172779098) has the molecular formula C4H6N2O10
and a molecular weight of 242.10 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;bis(nitric acid).
Molecular Properties
| Compound Name | (E)-but-2-enedioic acid;bis(nitric acid) |
| PubChem CID | 172779098 |
| Molecular Formula | C4H6N2O10 |
| Molecular Weight | 242.10 g/mol |
| Exact Mass | 242.00 |
| IUPAC Name | (E)-but-2-enedioic acid;bis(nitric acid) |
| SMILES | O=C(O)/C=C/C(=O)O.O=[N+]([O-])O.O=[N+]([O-])O |
| InChI | InChI=1S/C4H4O4.2HNO3/c5-3(6)1-2-4(7)8;2*2-1(3)4/h1-2H,(H,5,6)(H,7,8);2*(H,2,3,4)/b2-1+;; |
| InChIKey | NZYPOXUBRCLCFN-SEPHDYHBSA-N |
| XLogP | -0.98 |
| TPSA | 201.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.10 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioic acid;bis(nitric acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioic acid;bis(nitric acid)?
The IUPAC name of (E)-but-2-enedioic acid;bis(nitric acid) (CID 172779098) is (E)-but-2-enedioic acid;bis(nitric acid).
What is the SMILES notation for (E)-but-2-enedioic acid;bis(nitric acid)?
The canonical SMILES for (E)-but-2-enedioic acid;bis(nitric acid) is O=C(O)/C=C/C(=O)O.O=[N+]([O-])O.O=[N+]([O-])O.
What is the InChIKey of (E)-but-2-enedioic acid;bis(nitric acid)?
The InChIKey is NZYPOXUBRCLCFN-SEPHDYHBSA-N. The full InChI is InChI=1S/C4H4O4.2HNO3/c5-3(6)1-2-4(7)8;2*2-1(3)4/h1-2H,(H,5,6)(H,7,8);2*(H,2,3,4)/b2-1+;;.
What are the key properties of (E)-but-2-enedioic acid;bis(nitric acid)?
(E)-but-2-enedioic acid;bis(nitric acid) has a molecular weight of 242.10 g/mol, XLogP of -0.98, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioic acid;bis(nitric acid) is sourced from PubChem (CID 172779098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).