hydrogen peroxide;nitric acid

H3NO5 — CID 22590704

IUPAChydrogen peroxide;nitric acid
SMILESO=[N+]([O-])O.OO
InChIInChI=1S/HNO3.H2O2/c2-1(3)4;1-2/h(H,2,3,4);1-2H
InChIKeyQWARLPGIFZKIQW-UHFFFAOYSA-N
MW97.03 g/mol
LogP-0.33
Rot. Bonds

About hydrogen peroxide;nitric acid

hydrogen peroxide;nitric acid (PubChem CID 22590704) has the molecular formula H3NO5 and a molecular weight of 97.03 g/mol. Its IUPAC name is hydrogen peroxide;nitric acid.

Molecular Properties

Compound Namehydrogen peroxide;nitric acid
PubChem CID22590704
Molecular FormulaH3NO5
Molecular Weight97.03 g/mol
Exact Mass97.00
IUPAC Namehydrogen peroxide;nitric acid
SMILESO=[N+]([O-])O.OO
InChIInChI=1S/HNO3.H2O2/c2-1(3)4;1-2/h(H,2,3,4);1-2H
InChIKeyQWARLPGIFZKIQW-UHFFFAOYSA-N
XLogP-0.33
TPSA103.83 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms6
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 50097.03
LogP ≤ 5-0.33
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze hydrogen peroxide;nitric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hydrogen peroxide;nitric acid?
The IUPAC name of hydrogen peroxide;nitric acid (CID 22590704) is hydrogen peroxide;nitric acid.
What is the SMILES notation for hydrogen peroxide;nitric acid?
The canonical SMILES for hydrogen peroxide;nitric acid is O=[N+]([O-])O.OO.
What is the InChIKey of hydrogen peroxide;nitric acid?
The InChIKey is QWARLPGIFZKIQW-UHFFFAOYSA-N. The full InChI is InChI=1S/HNO3.H2O2/c2-1(3)4;1-2/h(H,2,3,4);1-2H.
What are the key properties of hydrogen peroxide;nitric acid?
hydrogen peroxide;nitric acid has a molecular weight of 97.03 g/mol, XLogP of -0.33, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen peroxide;nitric acid is sourced from PubChem (CID 22590704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).