About cadmium;bis(nitric acid)
cadmium;bis(nitric acid) (PubChem CID 72833329) has the molecular formula H2CdN2O6
and a molecular weight of 238.44 g/mol. Its IUPAC name is cadmium;bis(nitric acid).
Molecular Properties
| Compound Name | cadmium;bis(nitric acid) |
| PubChem CID | 72833329 |
| Molecular Formula | H2CdN2O6 |
| Molecular Weight | 238.44 g/mol |
| Exact Mass | 239.89 |
| IUPAC Name | cadmium;bis(nitric acid) |
| SMILES | O=[N+]([O-])O.O=[N+]([O-])O.[Cd] |
| InChI | InChI=1S/Cd.2HNO3/c;2*2-1(3)4/h;2*(H,2,3,4) |
| InChIKey | OQWUFYSTEGTOID-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.44 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cadmium;bis(nitric acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium;bis(nitric acid)?
The IUPAC name of cadmium;bis(nitric acid) (CID 72833329) is cadmium;bis(nitric acid).
What is the SMILES notation for cadmium;bis(nitric acid)?
The canonical SMILES for cadmium;bis(nitric acid) is O=[N+]([O-])O.O=[N+]([O-])O.[Cd].
What is the InChIKey of cadmium;bis(nitric acid)?
The InChIKey is OQWUFYSTEGTOID-UHFFFAOYSA-N. The full InChI is InChI=1S/Cd.2HNO3/c;2*2-1(3)4/h;2*(H,2,3,4).
What are the key properties of cadmium;bis(nitric acid)?
cadmium;bis(nitric acid) has a molecular weight of 238.44 g/mol, XLogP of -0.70, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium;bis(nitric acid) is sourced from PubChem (CID 72833329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).