About CID 173119618
CID 173119618 (PubChem CID 173119618) has the molecular formula H2N2O6Te
and a molecular weight of 253.62 g/mol.
Molecular Properties
| Compound Name | CID 173119618 |
| PubChem CID | 173119618 |
| Molecular Formula | H2N2O6Te |
| Molecular Weight | 253.62 g/mol |
| Exact Mass | 255.90 |
| IUPAC Name | — |
| SMILES | O=[N+]([O-])O.O=[N+]([O-])O.[Te] |
| InChI | InChI=1S/2HNO3.Te/c2*2-1(3)4;/h2*(H,2,3,4); |
| InChIKey | TXOFKQZVHMNEBC-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.62 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 173119618 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173119618?
The IUPAC name of CID 173119618 (CID 173119618) is not available.
What is the SMILES notation for CID 173119618?
The canonical SMILES for CID 173119618 is O=[N+]([O-])O.O=[N+]([O-])O.[Te].
What is the InChIKey of CID 173119618?
The InChIKey is TXOFKQZVHMNEBC-UHFFFAOYSA-N. The full InChI is InChI=1S/2HNO3.Te/c2*2-1(3)4;/h2*(H,2,3,4);.
What are the key properties of CID 173119618?
CID 173119618 has a molecular weight of 253.62 g/mol, XLogP of -1.08, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173119618 is sourced from PubChem (CID 173119618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).