About CID 173018650
CID 173018650 (PubChem CID 173018650) has the molecular formula H2N2O6Se
and a molecular weight of 204.98 g/mol.
Molecular Properties
| Compound Name | CID 173018650 |
| PubChem CID | 173018650 |
| Molecular Formula | H2N2O6Se |
| Molecular Weight | 204.98 g/mol |
| Exact Mass | 205.91 |
| IUPAC Name | — |
| SMILES | O=[N+]([O-])O.O=[N+]([O-])O.[Se] |
| InChI | InChI=1S/2HNO3.Se/c2*2-1(3)4;/h2*(H,2,3,4); |
| InChIKey | ZKSRWJNYYAIHKV-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.98 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 173018650 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173018650?
The IUPAC name of CID 173018650 (CID 173018650) is not available.
What is the SMILES notation for CID 173018650?
The canonical SMILES for CID 173018650 is O=[N+]([O-])O.O=[N+]([O-])O.[Se].
What is the InChIKey of CID 173018650?
The InChIKey is ZKSRWJNYYAIHKV-UHFFFAOYSA-N. The full InChI is InChI=1S/2HNO3.Se/c2*2-1(3)4;/h2*(H,2,3,4);.
What are the key properties of CID 173018650?
CID 173018650 has a molecular weight of 204.98 g/mol, XLogP of -1.08, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173018650 is sourced from PubChem (CID 173018650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).