carbonic acid;cerium;nitric acid

CH3CeNO6 — CID 174736285

IUPACcarbonic acid;cerium;nitric acid
SMILESO=C(O)O.O=[N+]([O-])O.[Ce]
InChIInChI=1S/CH2O3.Ce.HNO3/c2-1(3)4;;2-1(3)4/h(H2,2,3,4);;(H,2,3,4)
InChIKeyQQYPKMMFCPGHIS-UHFFFAOYSA-N
MW265.15 g/mol
LogP-0.13
Rot. Bonds

About carbonic acid;cerium;nitric acid

carbonic acid;cerium;nitric acid (PubChem CID 174736285) has the molecular formula CH3CeNO6 and a molecular weight of 265.15 g/mol. Its IUPAC name is carbonic acid;cerium;nitric acid.

Molecular Properties

Compound Namecarbonic acid;cerium;nitric acid
PubChem CID174736285
Molecular FormulaCH3CeNO6
Molecular Weight265.15 g/mol
Exact Mass264.90
IUPAC Namecarbonic acid;cerium;nitric acid
SMILESO=C(O)O.O=[N+]([O-])O.[Ce]
InChIInChI=1S/CH2O3.Ce.HNO3/c2-1(3)4;;2-1(3)4/h(H2,2,3,4);;(H,2,3,4)
InChIKeyQQYPKMMFCPGHIS-UHFFFAOYSA-N
XLogP-0.13
TPSA120.90 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.15
LogP ≤ 5-0.13
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze carbonic acid;cerium;nitric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbonic acid;cerium;nitric acid?
The IUPAC name of carbonic acid;cerium;nitric acid (CID 174736285) is carbonic acid;cerium;nitric acid.
What is the SMILES notation for carbonic acid;cerium;nitric acid?
The canonical SMILES for carbonic acid;cerium;nitric acid is O=C(O)O.O=[N+]([O-])O.[Ce].
What is the InChIKey of carbonic acid;cerium;nitric acid?
The InChIKey is QQYPKMMFCPGHIS-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2O3.Ce.HNO3/c2-1(3)4;;2-1(3)4/h(H2,2,3,4);;(H,2,3,4).
What are the key properties of carbonic acid;cerium;nitric acid?
carbonic acid;cerium;nitric acid has a molecular weight of 265.15 g/mol, XLogP of -0.13, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;cerium;nitric acid is sourced from PubChem (CID 174736285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).