carbonic acid;methane;nitric acid

C2H7NO6 — CID 172861779

IUPACcarbonic acid;methane;nitric acid
SMILESC.O=C(O)O.O=[N+]([O-])O
InChIInChI=1S/CH2O3.CH4.HNO3/c2-1(3)4;;2-1(3)4/h(H2,2,3,4);1H4;(H,2,3,4)
InChIKeyJGNCZQOSBBSZJN-UHFFFAOYSA-N
MW141.08 g/mol
LogP0.51
Rot. Bonds

About carbonic acid;methane;nitric acid

carbonic acid;methane;nitric acid (PubChem CID 172861779) has the molecular formula C2H7NO6 and a molecular weight of 141.08 g/mol. Its IUPAC name is carbonic acid;methane;nitric acid.

Molecular Properties

Compound Namecarbonic acid;methane;nitric acid
PubChem CID172861779
Molecular FormulaC2H7NO6
Molecular Weight141.08 g/mol
Exact Mass141.03
IUPAC Namecarbonic acid;methane;nitric acid
SMILESC.O=C(O)O.O=[N+]([O-])O
InChIInChI=1S/CH2O3.CH4.HNO3/c2-1(3)4;;2-1(3)4/h(H2,2,3,4);1H4;(H,2,3,4)
InChIKeyJGNCZQOSBBSZJN-UHFFFAOYSA-N
XLogP0.51
TPSA120.90 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500141.08
LogP ≤ 50.51
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze carbonic acid;methane;nitric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbonic acid;methane;nitric acid?
The IUPAC name of carbonic acid;methane;nitric acid (CID 172861779) is carbonic acid;methane;nitric acid.
What is the SMILES notation for carbonic acid;methane;nitric acid?
The canonical SMILES for carbonic acid;methane;nitric acid is C.O=C(O)O.O=[N+]([O-])O.
What is the InChIKey of carbonic acid;methane;nitric acid?
The InChIKey is JGNCZQOSBBSZJN-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2O3.CH4.HNO3/c2-1(3)4;;2-1(3)4/h(H2,2,3,4);1H4;(H,2,3,4).
What are the key properties of carbonic acid;methane;nitric acid?
carbonic acid;methane;nitric acid has a molecular weight of 141.08 g/mol, XLogP of 0.51, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;methane;nitric acid is sourced from PubChem (CID 172861779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).